About methyl 4-chloro-2-[2-(3,6-dihydro-2H-pyran-4-yl)ethylamino]-1,3-thiazole-5-carboxylate
methyl 4-chloro-2-[2-(3,6-dihydro-2H-pyran-4-yl)ethylamino]-1,3-thiazole-5-carboxylate (PubChem CID 133390548) has the molecular formula C12H15ClN2O3S
and a molecular weight of 302.78 g/mol. Its IUPAC name is methyl 4-chloro-2-[2-(3,6-dihydro-2H-pyran-4-yl)ethylamino]-1,3-thiazole-5-carboxylate.
Molecular Properties
| Compound Name | methyl 4-chloro-2-[2-(3,6-dihydro-2H-pyran-4-yl)ethylamino]-1,3-thiazole-5-carboxylate |
| PubChem CID | 133390548 |
| Molecular Formula | C12H15ClN2O3S |
| Molecular Weight | 302.78 g/mol |
| Exact Mass | 302.05 |
| IUPAC Name | methyl 4-chloro-2-[2-(3,6-dihydro-2H-pyran-4-yl)ethylamino]-1,3-thiazole-5-carboxylate |
| SMILES | COC(=O)c1sc(NCCC2=CCOCC2)nc1Cl |
| InChI | InChI=1S/C12H15ClN2O3S/c1-17-11(16)9-10(13)15-12(19-9)14-5-2-8-3-6-18-7-4-8/h3H,2,4-7H2,1H3,(H,14,15) |
| InChIKey | UOTDTIBNZXUYMM-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.78 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-chloro-2-[2-(3,6-dihydro-2H-pyran-4-yl)ethylamino]-1,3-thiazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-chloro-2-[2-(3,6-dihydro-2H-pyran-4-yl)ethylamino]-1,3-thiazole-5-carboxylate?
The IUPAC name of methyl 4-chloro-2-[2-(3,6-dihydro-2H-pyran-4-yl)ethylamino]-1,3-thiazole-5-carboxylate (CID 133390548) is methyl 4-chloro-2-[2-(3,6-dihydro-2H-pyran-4-yl)ethylamino]-1,3-thiazole-5-carboxylate.
What is the SMILES notation for methyl 4-chloro-2-[2-(3,6-dihydro-2H-pyran-4-yl)ethylamino]-1,3-thiazole-5-carboxylate?
The canonical SMILES for methyl 4-chloro-2-[2-(3,6-dihydro-2H-pyran-4-yl)ethylamino]-1,3-thiazole-5-carboxylate is COC(=O)c1sc(NCCC2=CCOCC2)nc1Cl.
What is the InChIKey of methyl 4-chloro-2-[2-(3,6-dihydro-2H-pyran-4-yl)ethylamino]-1,3-thiazole-5-carboxylate?
The InChIKey is UOTDTIBNZXUYMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15ClN2O3S/c1-17-11(16)9-10(13)15-12(19-9)14-5-2-8-3-6-18-7-4-8/h3H,2,4-7H2,1H3,(H,14,15).
What are the key properties of methyl 4-chloro-2-[2-(3,6-dihydro-2H-pyran-4-yl)ethylamino]-1,3-thiazole-5-carboxylate?
methyl 4-chloro-2-[2-(3,6-dihydro-2H-pyran-4-yl)ethylamino]-1,3-thiazole-5-carboxylate has a molecular weight of 302.78 g/mol, XLogP of 2.73, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-chloro-2-[2-(3,6-dihydro-2H-pyran-4-yl)ethylamino]-1,3-thiazole-5-carboxylate is sourced from PubChem (CID 133390548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).