C17H20N4 — CID 13339259
1,1-dimethyl-2-(5-phenyl-4,5-dihydro-1H-1,3-benzodiazepin-2-yl)hydrazine (PubChem CID 13339259) has the molecular formula C17H20N4 and a molecular weight of 280.38 g/mol. Its IUPAC name is 1,1-dimethyl-2-(5-phenyl-4,5-dihydro-1H-1,3-benzodiazepin-2-yl)hydrazine.
| Compound Name | 1,1-dimethyl-2-(5-phenyl-4,5-dihydro-1H-1,3-benzodiazepin-2-yl)hydrazine |
|---|---|
| PubChem CID | 13339259 |
| Molecular Formula | C17H20N4 |
| Molecular Weight | 280.38 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | 1,1-dimethyl-2-(5-phenyl-4,5-dihydro-1H-1,3-benzodiazepin-2-yl)hydrazine |
| SMILES | CN(C)NC1=NCC(c2ccccc2)c2ccccc2N1 |
| InChI | InChI=1S/C17H20N4/c1-21(2)20-17-18-12-15(13-8-4-3-5-9-13)14-10-6-7-11-16(14)19-17/h3-11,15H,12H2,1-2H3,(H2,18,19,20) |
| InChIKey | RLCZGFZVFKRWQX-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.38 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|