C13H16N6S — CID 133392657
6-[2-(3-propan-2-yl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)ethylamino]pyridine-2-carbonitrile (PubChem CID 133392657) has the molecular formula C13H16N6S and a molecular weight of 288.38 g/mol. Its IUPAC name is 6-[2-(3-propan-2-yl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)ethylamino]pyridine-2-carbonitrile.
| Compound Name | 6-[2-(3-propan-2-yl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)ethylamino]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 133392657 |
| Molecular Formula | C13H16N6S |
| Molecular Weight | 288.38 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | 6-[2-(3-propan-2-yl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)ethylamino]pyridine-2-carbonitrile |
| SMILES | CC(C)c1n[nH]c(=S)n1CCNc1cccc(C#N)n1 |
| InChI | InChI=1S/C13H16N6S/c1-9(2)12-17-18-13(20)19(12)7-6-15-11-5-3-4-10(8-14)16-11/h3-5,9H,6-7H2,1-2H3,(H,15,16)(H,18,20) |
| InChIKey | LWXDBNNYEUMSEO-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 82.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.38 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|