C18H16N4O4S2 — CID 133393146
5-cyclopropyl-3-(3-methylsulfonyl-2-nitrophenyl)sulfanyl-1-phenyl-1,2,4-triazole (PubChem CID 133393146) has the molecular formula C18H16N4O4S2 and a molecular weight of 416.48 g/mol. Its IUPAC name is 5-cyclopropyl-3-(3-methylsulfonyl-2-nitrophenyl)sulfanyl-1-phenyl-1,2,4-triazole.
| Compound Name | 5-cyclopropyl-3-(3-methylsulfonyl-2-nitrophenyl)sulfanyl-1-phenyl-1,2,4-triazole |
|---|---|
| PubChem CID | 133393146 |
| Molecular Formula | C18H16N4O4S2 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.06 |
| IUPAC Name | 5-cyclopropyl-3-(3-methylsulfonyl-2-nitrophenyl)sulfanyl-1-phenyl-1,2,4-triazole |
| SMILES | CS(=O)(=O)c1cccc(Sc2nc(C3CC3)n(-c3ccccc3)n2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C18H16N4O4S2/c1-28(25,26)15-9-5-8-14(16(15)22(23)24)27-18-19-17(12-10-11-12)21(20-18)13-6-3-2-4-7-13/h2-9,12H,10-11H2,1H3 |
| InChIKey | QKCUANARXJRQES-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 107.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|