C18H18FN3 — CID 133394408
8-fluoro-2-methyl-N-(1-pyridin-4-ylpropyl)quinolin-4-amine (PubChem CID 133394408) has the molecular formula C18H18FN3 and a molecular weight of 295.36 g/mol. Its IUPAC name is 8-fluoro-2-methyl-N-(1-pyridin-4-ylpropyl)quinolin-4-amine.
| Compound Name | 8-fluoro-2-methyl-N-(1-pyridin-4-ylpropyl)quinolin-4-amine |
|---|---|
| PubChem CID | 133394408 |
| Molecular Formula | C18H18FN3 |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.15 |
| IUPAC Name | 8-fluoro-2-methyl-N-(1-pyridin-4-ylpropyl)quinolin-4-amine |
| SMILES | CCC(Nc1cc(C)nc2c(F)cccc12)c1ccncc1 |
| InChI | InChI=1S/C18H18FN3/c1-3-16(13-7-9-20-10-8-13)22-17-11-12(2)21-18-14(17)5-4-6-15(18)19/h4-11,16H,3H2,1-2H3,(H,21,22) |
| InChIKey | KFFVZTCATHCTCM-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |