C20H20N4O4 — CID 133394722
3-nitro-2-(6-propoxy-3,4-dihydro-1H-isoquinolin-2-yl)pyrido[1,2-a]pyrimidin-4-one (PubChem CID 133394722) has the molecular formula C20H20N4O4 and a molecular weight of 380.40 g/mol. Its IUPAC name is 3-nitro-2-(6-propoxy-3,4-dihydro-1H-isoquinolin-2-yl)pyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 3-nitro-2-(6-propoxy-3,4-dihydro-1H-isoquinolin-2-yl)pyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 133394722 |
| Molecular Formula | C20H20N4O4 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | 3-nitro-2-(6-propoxy-3,4-dihydro-1H-isoquinolin-2-yl)pyrido[1,2-a]pyrimidin-4-one |
| SMILES | CCCOc1ccc2c(c1)CCN(c1nc3ccccn3c(=O)c1[N+](=O)[O-])C2 |
| InChI | InChI=1S/C20H20N4O4/c1-2-11-28-16-7-6-15-13-22(10-8-14(15)12-16)19-18(24(26)27)20(25)23-9-4-3-5-17(23)21-19/h3-7,9,12H,2,8,10-11,13H2,1H3 |
| InChIKey | XFSJYMFAUGVPCK-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|