About [1-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]piperidin-4-yl]-(1-methylimidazol-2-yl)methanol
[1-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]piperidin-4-yl]-(1-methylimidazol-2-yl)methanol (PubChem CID 133395803) has the molecular formula C19H21FN4OS
and a molecular weight of 372.47 g/mol. Its IUPAC name is [1-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]piperidin-4-yl]-(1-methylimidazol-2-yl)methanol.
Molecular Properties
| Compound Name | [1-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]piperidin-4-yl]-(1-methylimidazol-2-yl)methanol |
| PubChem CID | 133395803 |
| Molecular Formula | C19H21FN4OS |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | [1-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]piperidin-4-yl]-(1-methylimidazol-2-yl)methanol |
| SMILES | Cn1ccnc1C(O)C1CCN(c2nc(-c3ccc(F)cc3)cs2)CC1 |
| InChI | InChI=1S/C19H21FN4OS/c1-23-11-8-21-18(23)17(25)14-6-9-24(10-7-14)19-22-16(12-26-19)13-2-4-15(20)5-3-13/h2-5,8,11-12,14,17,25H,6-7,9-10H2,1H3 |
| InChIKey | LSFWERPMGLPRTL-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [1-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]piperidin-4-yl]-(1-methylimidazol-2-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]piperidin-4-yl]-(1-methylimidazol-2-yl)methanol?
The IUPAC name of [1-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]piperidin-4-yl]-(1-methylimidazol-2-yl)methanol (CID 133395803) is [1-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]piperidin-4-yl]-(1-methylimidazol-2-yl)methanol.
What is the SMILES notation for [1-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]piperidin-4-yl]-(1-methylimidazol-2-yl)methanol?
The canonical SMILES for [1-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]piperidin-4-yl]-(1-methylimidazol-2-yl)methanol is Cn1ccnc1C(O)C1CCN(c2nc(-c3ccc(F)cc3)cs2)CC1.
What is the InChIKey of [1-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]piperidin-4-yl]-(1-methylimidazol-2-yl)methanol?
The InChIKey is LSFWERPMGLPRTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21FN4OS/c1-23-11-8-21-18(23)17(25)14-6-9-24(10-7-14)19-22-16(12-26-19)13-2-4-15(20)5-3-13/h2-5,8,11-12,14,17,25H,6-7,9-10H2,1H3.
What are the key properties of [1-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]piperidin-4-yl]-(1-methylimidazol-2-yl)methanol?
[1-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]piperidin-4-yl]-(1-methylimidazol-2-yl)methanol has a molecular weight of 372.47 g/mol, XLogP of 3.63, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]piperidin-4-yl]-(1-methylimidazol-2-yl)methanol is sourced from PubChem (CID 133395803), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).