C9H6Cl5NO — CID 13339635
3,6-dichloro-2-[2-(2,2,2-trichloroethyl)oxiran-2-yl]pyridine (PubChem CID 13339635) has the molecular formula C9H6Cl5NO and a molecular weight of 321.42 g/mol. Its IUPAC name is 3,6-dichloro-2-[2-(2,2,2-trichloroethyl)oxiran-2-yl]pyridine.
| Compound Name | 3,6-dichloro-2-[2-(2,2,2-trichloroethyl)oxiran-2-yl]pyridine |
|---|---|
| PubChem CID | 13339635 |
| Molecular Formula | C9H6Cl5NO |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 318.89 |
| IUPAC Name | 3,6-dichloro-2-[2-(2,2,2-trichloroethyl)oxiran-2-yl]pyridine |
| SMILES | Clc1ccc(Cl)c(C2(CC(Cl)(Cl)Cl)CO2)n1 |
| InChI | InChI=1S/C9H6Cl5NO/c10-5-1-2-6(11)15-7(5)8(4-16-8)3-9(12,13)14/h1-2H,3-4H2 |
| InChIKey | JDEQGJRHXCQGAD-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 25.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|