C13H18ClN5O — CID 133398235
5-chloro-2-methoxy-N-methyl-N-[3-(2-methylimidazol-1-yl)propyl]pyrimidin-4-amine (PubChem CID 133398235) has the molecular formula C13H18ClN5O and a molecular weight of 295.77 g/mol. Its IUPAC name is 5-chloro-2-methoxy-N-methyl-N-[3-(2-methylimidazol-1-yl)propyl]pyrimidin-4-amine.
| Compound Name | 5-chloro-2-methoxy-N-methyl-N-[3-(2-methylimidazol-1-yl)propyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 133398235 |
| Molecular Formula | C13H18ClN5O |
| Molecular Weight | 295.77 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | 5-chloro-2-methoxy-N-methyl-N-[3-(2-methylimidazol-1-yl)propyl]pyrimidin-4-amine |
| SMILES | COc1ncc(Cl)c(N(C)CCCn2ccnc2C)n1 |
| InChI | InChI=1S/C13H18ClN5O/c1-10-15-5-8-19(10)7-4-6-18(2)12-11(14)9-16-13(17-12)20-3/h5,8-9H,4,6-7H2,1-3H3 |
| InChIKey | VABUOZDFRLTNIS-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 56.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.77 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |