C17H22N4 — CID 133398408
N-(2-cyclopropylethyl)-6-ethyl-N-methyl-2-pyridin-2-ylpyrimidin-4-amine (PubChem CID 133398408) has the molecular formula C17H22N4 and a molecular weight of 282.39 g/mol. Its IUPAC name is N-(2-cyclopropylethyl)-6-ethyl-N-methyl-2-pyridin-2-ylpyrimidin-4-amine.
| Compound Name | N-(2-cyclopropylethyl)-6-ethyl-N-methyl-2-pyridin-2-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 133398408 |
| Molecular Formula | C17H22N4 |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | N-(2-cyclopropylethyl)-6-ethyl-N-methyl-2-pyridin-2-ylpyrimidin-4-amine |
| SMILES | CCc1cc(N(C)CCC2CC2)nc(-c2ccccn2)n1 |
| InChI | InChI=1S/C17H22N4/c1-3-14-12-16(21(2)11-9-13-7-8-13)20-17(19-14)15-6-4-5-10-18-15/h4-6,10,12-13H,3,7-9,11H2,1-2H3 |
| InChIKey | SMBYIMOBTWCTOC-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |