C13H13F3N4OS — CID 133398760
5-cyclopropyl-N-[2-[[3-(trifluoromethyl)-2-pyridinyl]oxy]ethyl]-1,3,4-thiadiazol-2-amine (PubChem CID 133398760) has the molecular formula C13H13F3N4OS and a molecular weight of 330.34 g/mol. Its IUPAC name is 5-cyclopropyl-N-[2-[[3-(trifluoromethyl)-2-pyridinyl]oxy]ethyl]-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-cyclopropyl-N-[2-[[3-(trifluoromethyl)-2-pyridinyl]oxy]ethyl]-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 133398760 |
| Molecular Formula | C13H13F3N4OS |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | 5-cyclopropyl-N-[2-[[3-(trifluoromethyl)-2-pyridinyl]oxy]ethyl]-1,3,4-thiadiazol-2-amine |
| SMILES | FC(F)(F)c1cccnc1OCCNc1nnc(C2CC2)s1 |
| InChI | InChI=1S/C13H13F3N4OS/c14-13(15,16)9-2-1-5-17-10(9)21-7-6-18-12-20-19-11(22-12)8-3-4-8/h1-2,5,8H,3-4,6-7H2,(H,18,20) |
| InChIKey | XRCZCTXJTHJBBZ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|