About [3-[(thieno[3,2-b]pyridin-7-ylamino)methyl]oxetan-3-yl]methanol
[3-[(thieno[3,2-b]pyridin-7-ylamino)methyl]oxetan-3-yl]methanol (PubChem CID 133399177) has the molecular formula C12H14N2O2S
and a molecular weight of 250.32 g/mol. Its IUPAC name is [3-[(thieno[3,2-b]pyridin-7-ylamino)methyl]oxetan-3-yl]methanol.
Molecular Properties
| Compound Name | [3-[(thieno[3,2-b]pyridin-7-ylamino)methyl]oxetan-3-yl]methanol |
| PubChem CID | 133399177 |
| Molecular Formula | C12H14N2O2S |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | [3-[(thieno[3,2-b]pyridin-7-ylamino)methyl]oxetan-3-yl]methanol |
| SMILES | OCC1(CNc2ccnc3ccsc23)COC1 |
| InChI | InChI=1S/C12H14N2O2S/c15-6-12(7-16-8-12)5-14-9-1-3-13-10-2-4-17-11(9)10/h1-4,15H,5-8H2,(H,13,14) |
| InChIKey | PTTFHONPCBPXOE-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [3-[(thieno[3,2-b]pyridin-7-ylamino)methyl]oxetan-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[(thieno[3,2-b]pyridin-7-ylamino)methyl]oxetan-3-yl]methanol?
The IUPAC name of [3-[(thieno[3,2-b]pyridin-7-ylamino)methyl]oxetan-3-yl]methanol (CID 133399177) is [3-[(thieno[3,2-b]pyridin-7-ylamino)methyl]oxetan-3-yl]methanol.
What is the SMILES notation for [3-[(thieno[3,2-b]pyridin-7-ylamino)methyl]oxetan-3-yl]methanol?
The canonical SMILES for [3-[(thieno[3,2-b]pyridin-7-ylamino)methyl]oxetan-3-yl]methanol is OCC1(CNc2ccnc3ccsc23)COC1.
What is the InChIKey of [3-[(thieno[3,2-b]pyridin-7-ylamino)methyl]oxetan-3-yl]methanol?
The InChIKey is PTTFHONPCBPXOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2O2S/c15-6-12(7-16-8-12)5-14-9-1-3-13-10-2-4-17-11(9)10/h1-4,15H,5-8H2,(H,13,14).
What are the key properties of [3-[(thieno[3,2-b]pyridin-7-ylamino)methyl]oxetan-3-yl]methanol?
[3-[(thieno[3,2-b]pyridin-7-ylamino)methyl]oxetan-3-yl]methanol has a molecular weight of 250.32 g/mol, XLogP of 1.72, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[(thieno[3,2-b]pyridin-7-ylamino)methyl]oxetan-3-yl]methanol is sourced from PubChem (CID 133399177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).