C26H31N3O7 — CID 13339952
(2S)-2-[[(3S)-1-(carboxymethyl)-2-oxo-4,5-dihydro-3H-1-benzazepin-3-yl]amino]-6-(phenylmethoxycarbonylamino)hexanoic acid (PubChem CID 13339952) has the molecular formula C26H31N3O7 and a molecular weight of 497.55 g/mol. Its IUPAC name is (2S)-2-[[(3S)-1-(carboxymethyl)-2-oxo-4,5-dihydro-3H-1-benzazepin-3-yl]amino]-6-(phenylmethoxycarbonylamino)hexanoic acid.
| Compound Name | (2S)-2-[[(3S)-1-(carboxymethyl)-2-oxo-4,5-dihydro-3H-1-benzazepin-3-yl]amino]-6-(phenylmethoxycarbonylamino)hexanoic acid |
|---|---|
| PubChem CID | 13339952 |
| Molecular Formula | C26H31N3O7 |
| Molecular Weight | 497.55 g/mol |
| Exact Mass | 497.22 |
| IUPAC Name | (2S)-2-[[(3S)-1-(carboxymethyl)-2-oxo-4,5-dihydro-3H-1-benzazepin-3-yl]amino]-6-(phenylmethoxycarbonylamino)hexanoic acid |
| SMILES | O=C(O)CN1C(=O)[C@@H](N[C@@H](CCCCNC(=O)OCc2ccccc2)C(=O)O)CCc2ccccc21 |
| InChI | InChI=1S/C26H31N3O7/c30-23(31)16-29-22-12-5-4-10-19(22)13-14-20(24(29)32)28-21(25(33)34)11-6-7-15-27-26(35)36-17-18-8-2-1-3-9-18/h1-5,8-10,12,20-21,28H,6-7,11,13-17H2,(H,27,35)(H,30,31)(H,33,34)/t20-,21-/m0/s1 |
| InChIKey | WKNDKOZNFFZORF-SFTDATJTSA-N |
| XLogP | 2.56 |
| TPSA | 145.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.55 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|