About 2-tert-butyl-4-[4-(3,5-dichloro-2-pyridinyl)piperazin-1-yl]-6-(methoxymethyl)pyrimidine
2-tert-butyl-4-[4-(3,5-dichloro-2-pyridinyl)piperazin-1-yl]-6-(methoxymethyl)pyrimidine (PubChem CID 133400574) has the molecular formula C19H25Cl2N5O
and a molecular weight of 410.35 g/mol. Its IUPAC name is 2-tert-butyl-4-[4-(3,5-dichloro-2-pyridinyl)piperazin-1-yl]-6-(methoxymethyl)pyrimidine.
Molecular Properties
| Compound Name | 2-tert-butyl-4-[4-(3,5-dichloro-2-pyridinyl)piperazin-1-yl]-6-(methoxymethyl)pyrimidine |
| PubChem CID | 133400574 |
| Molecular Formula | C19H25Cl2N5O |
| Molecular Weight | 410.35 g/mol |
| Exact Mass | 409.14 |
| IUPAC Name | 2-tert-butyl-4-[4-(3,5-dichloro-2-pyridinyl)piperazin-1-yl]-6-(methoxymethyl)pyrimidine |
| SMILES | COCc1cc(N2CCN(c3ncc(Cl)cc3Cl)CC2)nc(C(C)(C)C)n1 |
| InChI | InChI=1S/C19H25Cl2N5O/c1-19(2,3)18-23-14(12-27-4)10-16(24-18)25-5-7-26(8-6-25)17-15(21)9-13(20)11-22-17/h9-11H,5-8,12H2,1-4H3 |
| InChIKey | VFYPQCNVZDDIDP-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 54.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 410.35 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-tert-butyl-4-[4-(3,5-dichloro-2-pyridinyl)piperazin-1-yl]-6-(methoxymethyl)pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-4-[4-(3,5-dichloro-2-pyridinyl)piperazin-1-yl]-6-(methoxymethyl)pyrimidine?
The IUPAC name of 2-tert-butyl-4-[4-(3,5-dichloro-2-pyridinyl)piperazin-1-yl]-6-(methoxymethyl)pyrimidine (CID 133400574) is 2-tert-butyl-4-[4-(3,5-dichloro-2-pyridinyl)piperazin-1-yl]-6-(methoxymethyl)pyrimidine.
What is the SMILES notation for 2-tert-butyl-4-[4-(3,5-dichloro-2-pyridinyl)piperazin-1-yl]-6-(methoxymethyl)pyrimidine?
The canonical SMILES for 2-tert-butyl-4-[4-(3,5-dichloro-2-pyridinyl)piperazin-1-yl]-6-(methoxymethyl)pyrimidine is COCc1cc(N2CCN(c3ncc(Cl)cc3Cl)CC2)nc(C(C)(C)C)n1.
What is the InChIKey of 2-tert-butyl-4-[4-(3,5-dichloro-2-pyridinyl)piperazin-1-yl]-6-(methoxymethyl)pyrimidine?
The InChIKey is VFYPQCNVZDDIDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H25Cl2N5O/c1-19(2,3)18-23-14(12-27-4)10-16(24-18)25-5-7-26(8-6-25)17-15(21)9-13(20)11-22-17/h9-11H,5-8,12H2,1-4H3.
What are the key properties of 2-tert-butyl-4-[4-(3,5-dichloro-2-pyridinyl)piperazin-1-yl]-6-(methoxymethyl)pyrimidine?
2-tert-butyl-4-[4-(3,5-dichloro-2-pyridinyl)piperazin-1-yl]-6-(methoxymethyl)pyrimidine has a molecular weight of 410.35 g/mol, XLogP of 3.95, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-4-[4-(3,5-dichloro-2-pyridinyl)piperazin-1-yl]-6-(methoxymethyl)pyrimidine is sourced from PubChem (CID 133400574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).