C16H23N3O5S — CID 133400732
N-cyclohexyl-3-(3-methylsulfonyl-4-nitroanilino)propanamide (PubChem CID 133400732) has the molecular formula C16H23N3O5S and a molecular weight of 369.44 g/mol. Its IUPAC name is N-cyclohexyl-3-(3-methylsulfonyl-4-nitroanilino)propanamide.
| Compound Name | N-cyclohexyl-3-(3-methylsulfonyl-4-nitroanilino)propanamide |
|---|---|
| PubChem CID | 133400732 |
| Molecular Formula | C16H23N3O5S |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | N-cyclohexyl-3-(3-methylsulfonyl-4-nitroanilino)propanamide |
| SMILES | CS(=O)(=O)c1cc(NCCC(=O)NC2CCCCC2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H23N3O5S/c1-25(23,24)15-11-13(7-8-14(15)19(21)22)17-10-9-16(20)18-12-5-3-2-4-6-12/h7-8,11-12,17H,2-6,9-10H2,1H3,(H,18,20) |
| InChIKey | MQFHNCIIGKQZSF-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 118.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|