C18H32N4O — CID 133400878
2-tert-butyl-6-(methoxymethyl)-N-[2-(1-methylpiperidin-4-yl)ethyl]pyrimidin-4-amine (PubChem CID 133400878) has the molecular formula C18H32N4O and a molecular weight of 320.48 g/mol. Its IUPAC name is 2-tert-butyl-6-(methoxymethyl)-N-[2-(1-methylpiperidin-4-yl)ethyl]pyrimidin-4-amine.
| Compound Name | 2-tert-butyl-6-(methoxymethyl)-N-[2-(1-methylpiperidin-4-yl)ethyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 133400878 |
| Molecular Formula | C18H32N4O |
| Molecular Weight | 320.48 g/mol |
| Exact Mass | 320.26 |
| IUPAC Name | 2-tert-butyl-6-(methoxymethyl)-N-[2-(1-methylpiperidin-4-yl)ethyl]pyrimidin-4-amine |
| SMILES | COCc1cc(NCCC2CCN(C)CC2)nc(C(C)(C)C)n1 |
| InChI | InChI=1S/C18H32N4O/c1-18(2,3)17-20-15(13-23-5)12-16(21-17)19-9-6-14-7-10-22(4)11-8-14/h12,14H,6-11,13H2,1-5H3,(H,19,20,21) |
| InChIKey | DSCNEYNWUMJNRZ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.48 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |