About 2-tert-butyl-N-[1-(2,2-difluoroethyl)pyrazol-4-yl]-6-(methoxymethyl)pyrimidin-4-amine
2-tert-butyl-N-[1-(2,2-difluoroethyl)pyrazol-4-yl]-6-(methoxymethyl)pyrimidin-4-amine (PubChem CID 133401999) has the molecular formula C15H21F2N5O
and a molecular weight of 325.36 g/mol. Its IUPAC name is 2-tert-butyl-N-[1-(2,2-difluoroethyl)pyrazol-4-yl]-6-(methoxymethyl)pyrimidin-4-amine.
Molecular Properties
| Compound Name | 2-tert-butyl-N-[1-(2,2-difluoroethyl)pyrazol-4-yl]-6-(methoxymethyl)pyrimidin-4-amine |
| PubChem CID | 133401999 |
| Molecular Formula | C15H21F2N5O |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.17 |
| IUPAC Name | 2-tert-butyl-N-[1-(2,2-difluoroethyl)pyrazol-4-yl]-6-(methoxymethyl)pyrimidin-4-amine |
| SMILES | COCc1cc(Nc2cnn(CC(F)F)c2)nc(C(C)(C)C)n1 |
| InChI | InChI=1S/C15H21F2N5O/c1-15(2,3)14-20-10(9-23-4)5-13(21-14)19-11-6-18-22(7-11)8-12(16)17/h5-7,12H,8-9H2,1-4H3,(H,19,20,21) |
| InChIKey | IMWUJCMVUOHUPP-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-tert-butyl-N-[1-(2,2-difluoroethyl)pyrazol-4-yl]-6-(methoxymethyl)pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-N-[1-(2,2-difluoroethyl)pyrazol-4-yl]-6-(methoxymethyl)pyrimidin-4-amine?
The IUPAC name of 2-tert-butyl-N-[1-(2,2-difluoroethyl)pyrazol-4-yl]-6-(methoxymethyl)pyrimidin-4-amine (CID 133401999) is 2-tert-butyl-N-[1-(2,2-difluoroethyl)pyrazol-4-yl]-6-(methoxymethyl)pyrimidin-4-amine.
What is the SMILES notation for 2-tert-butyl-N-[1-(2,2-difluoroethyl)pyrazol-4-yl]-6-(methoxymethyl)pyrimidin-4-amine?
The canonical SMILES for 2-tert-butyl-N-[1-(2,2-difluoroethyl)pyrazol-4-yl]-6-(methoxymethyl)pyrimidin-4-amine is COCc1cc(Nc2cnn(CC(F)F)c2)nc(C(C)(C)C)n1.
What is the InChIKey of 2-tert-butyl-N-[1-(2,2-difluoroethyl)pyrazol-4-yl]-6-(methoxymethyl)pyrimidin-4-amine?
The InChIKey is IMWUJCMVUOHUPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21F2N5O/c1-15(2,3)14-20-10(9-23-4)5-13(21-14)19-11-6-18-22(7-11)8-12(16)17/h5-7,12H,8-9H2,1-4H3,(H,19,20,21).
What are the key properties of 2-tert-butyl-N-[1-(2,2-difluoroethyl)pyrazol-4-yl]-6-(methoxymethyl)pyrimidin-4-amine?
2-tert-butyl-N-[1-(2,2-difluoroethyl)pyrazol-4-yl]-6-(methoxymethyl)pyrimidin-4-amine has a molecular weight of 325.36 g/mol, XLogP of 3.13, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-N-[1-(2,2-difluoroethyl)pyrazol-4-yl]-6-(methoxymethyl)pyrimidin-4-amine is sourced from PubChem (CID 133401999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).