About 2-[2-(3,5-dichlorophenyl)-3-hydroxy-5-oxo-1H-pyrazol-4-yl]indol-3-one
2-[2-(3,5-dichlorophenyl)-3-hydroxy-5-oxo-1H-pyrazol-4-yl]indol-3-one (PubChem CID 1334022) has the molecular formula C17H9Cl2N3O3
and a molecular weight of 374.18 g/mol. Its IUPAC name is 2-[2-(3,5-dichlorophenyl)-3-hydroxy-5-oxo-1H-pyrazol-4-yl]indol-3-one.
Molecular Properties
| Compound Name | 2-[2-(3,5-dichlorophenyl)-3-hydroxy-5-oxo-1H-pyrazol-4-yl]indol-3-one |
| PubChem CID | 1334022 |
| Molecular Formula | C17H9Cl2N3O3 |
| Molecular Weight | 374.18 g/mol |
| Exact Mass | 373.00 |
| IUPAC Name | 2-[2-(3,5-dichlorophenyl)-3-hydroxy-5-oxo-1H-pyrazol-4-yl]indol-3-one |
| SMILES | O=C1C(c2c(O)n(-c3cc(Cl)cc(Cl)c3)[nH]c2=O)=Nc2ccccc21 |
| InChI | InChI=1S/C17H9Cl2N3O3/c18-8-5-9(19)7-10(6-8)22-17(25)13(16(24)21-22)14-15(23)11-3-1-2-4-12(11)20-14/h1-7,25H,(H,21,24) |
| InChIKey | QQSRQGZZNAECES-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 87.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.18 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[2-(3,5-dichlorophenyl)-3-hydroxy-5-oxo-1H-pyrazol-4-yl]indol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(3,5-dichlorophenyl)-3-hydroxy-5-oxo-1H-pyrazol-4-yl]indol-3-one?
The IUPAC name of 2-[2-(3,5-dichlorophenyl)-3-hydroxy-5-oxo-1H-pyrazol-4-yl]indol-3-one (CID 1334022) is 2-[2-(3,5-dichlorophenyl)-3-hydroxy-5-oxo-1H-pyrazol-4-yl]indol-3-one.
What is the SMILES notation for 2-[2-(3,5-dichlorophenyl)-3-hydroxy-5-oxo-1H-pyrazol-4-yl]indol-3-one?
The canonical SMILES for 2-[2-(3,5-dichlorophenyl)-3-hydroxy-5-oxo-1H-pyrazol-4-yl]indol-3-one is O=C1C(c2c(O)n(-c3cc(Cl)cc(Cl)c3)[nH]c2=O)=Nc2ccccc21.
What is the InChIKey of 2-[2-(3,5-dichlorophenyl)-3-hydroxy-5-oxo-1H-pyrazol-4-yl]indol-3-one?
The InChIKey is QQSRQGZZNAECES-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H9Cl2N3O3/c18-8-5-9(19)7-10(6-8)22-17(25)13(16(24)21-22)14-15(23)11-3-1-2-4-12(11)20-14/h1-7,25H,(H,21,24).
What are the key properties of 2-[2-(3,5-dichlorophenyl)-3-hydroxy-5-oxo-1H-pyrazol-4-yl]indol-3-one?
2-[2-(3,5-dichlorophenyl)-3-hydroxy-5-oxo-1H-pyrazol-4-yl]indol-3-one has a molecular weight of 374.18 g/mol, XLogP of 3.50, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(3,5-dichlorophenyl)-3-hydroxy-5-oxo-1H-pyrazol-4-yl]indol-3-one is sourced from PubChem (CID 1334022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).