About 4-(2-ethylthieno[2,3-d]pyrimidin-4-yl)-3-(5-methylfuran-2-yl)morpholine
4-(2-ethylthieno[2,3-d]pyrimidin-4-yl)-3-(5-methylfuran-2-yl)morpholine (PubChem CID 133403948) has the molecular formula C17H19N3O2S
and a molecular weight of 329.43 g/mol. Its IUPAC name is 4-(2-ethylthieno[2,3-d]pyrimidin-4-yl)-3-(5-methylfuran-2-yl)morpholine.
Molecular Properties
| Compound Name | 4-(2-ethylthieno[2,3-d]pyrimidin-4-yl)-3-(5-methylfuran-2-yl)morpholine |
| PubChem CID | 133403948 |
| Molecular Formula | C17H19N3O2S |
| Molecular Weight | 329.43 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | 4-(2-ethylthieno[2,3-d]pyrimidin-4-yl)-3-(5-methylfuran-2-yl)morpholine |
| SMILES | CCc1nc(N2CCOCC2c2ccc(C)o2)c2ccsc2n1 |
| InChI | InChI=1S/C17H19N3O2S/c1-3-15-18-16(12-6-9-23-17(12)19-15)20-7-8-21-10-13(20)14-5-4-11(2)22-14/h4-6,9,13H,3,7-8,10H2,1-2H3 |
| InChIKey | XBDLWRLCIAILSL-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 51.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.43 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-(2-ethylthieno[2,3-d]pyrimidin-4-yl)-3-(5-methylfuran-2-yl)morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-ethylthieno[2,3-d]pyrimidin-4-yl)-3-(5-methylfuran-2-yl)morpholine?
The IUPAC name of 4-(2-ethylthieno[2,3-d]pyrimidin-4-yl)-3-(5-methylfuran-2-yl)morpholine (CID 133403948) is 4-(2-ethylthieno[2,3-d]pyrimidin-4-yl)-3-(5-methylfuran-2-yl)morpholine.
What is the SMILES notation for 4-(2-ethylthieno[2,3-d]pyrimidin-4-yl)-3-(5-methylfuran-2-yl)morpholine?
The canonical SMILES for 4-(2-ethylthieno[2,3-d]pyrimidin-4-yl)-3-(5-methylfuran-2-yl)morpholine is CCc1nc(N2CCOCC2c2ccc(C)o2)c2ccsc2n1.
What is the InChIKey of 4-(2-ethylthieno[2,3-d]pyrimidin-4-yl)-3-(5-methylfuran-2-yl)morpholine?
The InChIKey is XBDLWRLCIAILSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19N3O2S/c1-3-15-18-16(12-6-9-23-17(12)19-15)20-7-8-21-10-13(20)14-5-4-11(2)22-14/h4-6,9,13H,3,7-8,10H2,1-2H3.
What are the key properties of 4-(2-ethylthieno[2,3-d]pyrimidin-4-yl)-3-(5-methylfuran-2-yl)morpholine?
4-(2-ethylthieno[2,3-d]pyrimidin-4-yl)-3-(5-methylfuran-2-yl)morpholine has a molecular weight of 329.43 g/mol, XLogP of 3.73, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-ethylthieno[2,3-d]pyrimidin-4-yl)-3-(5-methylfuran-2-yl)morpholine is sourced from PubChem (CID 133403948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).