C16H18N8OS — CID 133405345
2-ethyl-N-[2-methyl-1-[3-(1H-1,2,4-triazol-5-yl)-1,2,4-oxadiazol-5-yl]propyl]thieno[2,3-d]pyrimidin-4-amine (PubChem CID 133405345) has the molecular formula C16H18N8OS and a molecular weight of 370.44 g/mol. Its IUPAC name is 2-ethyl-N-[2-methyl-1-[3-(1H-1,2,4-triazol-5-yl)-1,2,4-oxadiazol-5-yl]propyl]thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | 2-ethyl-N-[2-methyl-1-[3-(1H-1,2,4-triazol-5-yl)-1,2,4-oxadiazol-5-yl]propyl]thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 133405345 |
| Molecular Formula | C16H18N8OS |
| Molecular Weight | 370.44 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | 2-ethyl-N-[2-methyl-1-[3-(1H-1,2,4-triazol-5-yl)-1,2,4-oxadiazol-5-yl]propyl]thieno[2,3-d]pyrimidin-4-amine |
| SMILES | CCc1nc(NC(c2nc(-c3ncn[nH]3)no2)C(C)C)c2ccsc2n1 |
| InChI | InChI=1S/C16H18N8OS/c1-4-10-19-12(9-5-6-26-16(9)20-10)21-11(8(2)3)15-22-14(24-25-15)13-17-7-18-23-13/h5-8,11H,4H2,1-3H3,(H,17,18,23)(H,19,20,21) |
| InChIKey | LKIPVEALWFMGGH-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 118.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.44 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |