C17H24N4OS — CID 133405482
3-cyclohexyl-3-[(2-ethylthieno[2,3-d]pyrimidin-4-yl)amino]propanamide (PubChem CID 133405482) has the molecular formula C17H24N4OS and a molecular weight of 332.47 g/mol. Its IUPAC name is 3-cyclohexyl-3-[(2-ethylthieno[2,3-d]pyrimidin-4-yl)amino]propanamide.
| Compound Name | 3-cyclohexyl-3-[(2-ethylthieno[2,3-d]pyrimidin-4-yl)amino]propanamide |
|---|---|
| PubChem CID | 133405482 |
| Molecular Formula | C17H24N4OS |
| Molecular Weight | 332.47 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | 3-cyclohexyl-3-[(2-ethylthieno[2,3-d]pyrimidin-4-yl)amino]propanamide |
| SMILES | CCc1nc(NC(CC(N)=O)C2CCCCC2)c2ccsc2n1 |
| InChI | InChI=1S/C17H24N4OS/c1-2-15-20-16(12-8-9-23-17(12)21-15)19-13(10-14(18)22)11-6-4-3-5-7-11/h8-9,11,13H,2-7,10H2,1H3,(H2,18,22)(H,19,20,21) |
| InChIKey | JPPGOKDLFVFHFC-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.47 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |