C15H15N5O2 — CID 133405682
N-[(1,5-dimethylpyrazol-4-yl)methyl]-6-nitroquinolin-2-amine (PubChem CID 133405682) has the molecular formula C15H15N5O2 and a molecular weight of 297.32 g/mol. Its IUPAC name is N-[(1,5-dimethylpyrazol-4-yl)methyl]-6-nitroquinolin-2-amine.
| Compound Name | N-[(1,5-dimethylpyrazol-4-yl)methyl]-6-nitroquinolin-2-amine |
|---|---|
| PubChem CID | 133405682 |
| Molecular Formula | C15H15N5O2 |
| Molecular Weight | 297.32 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | N-[(1,5-dimethylpyrazol-4-yl)methyl]-6-nitroquinolin-2-amine |
| SMILES | Cc1c(CNc2ccc3cc([N+](=O)[O-])ccc3n2)cnn1C |
| InChI | InChI=1S/C15H15N5O2/c1-10-12(9-17-19(10)2)8-16-15-6-3-11-7-13(20(21)22)4-5-14(11)18-15/h3-7,9H,8H2,1-2H3,(H,16,18) |
| InChIKey | QJSOSZOZIRIGNR-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 85.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.32 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|