About 1-tert-butyl-4-(4-but-3-ynylpiperazin-1-yl)pyrazolo[5,4-d]pyrimidine
1-tert-butyl-4-(4-but-3-ynylpiperazin-1-yl)pyrazolo[5,4-d]pyrimidine (PubChem CID 133407070) has the molecular formula C17H24N6
and a molecular weight of 312.42 g/mol. Its IUPAC name is 1-tert-butyl-4-(4-but-3-ynylpiperazin-1-yl)pyrazolo[5,4-d]pyrimidine.
Molecular Properties
| Compound Name | 1-tert-butyl-4-(4-but-3-ynylpiperazin-1-yl)pyrazolo[5,4-d]pyrimidine |
| PubChem CID | 133407070 |
| Molecular Formula | C17H24N6 |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.21 |
| IUPAC Name | 1-tert-butyl-4-(4-but-3-ynylpiperazin-1-yl)pyrazolo[5,4-d]pyrimidine |
| SMILES | C#CCCN1CCN(c2ncnc3c2cnn3C(C)(C)C)CC1 |
| InChI | InChI=1S/C17H24N6/c1-5-6-7-21-8-10-22(11-9-21)15-14-12-20-23(17(2,3)4)16(14)19-13-18-15/h1,12-13H,6-11H2,2-4H3 |
| InChIKey | LZUIGMMPYAGEMO-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-tert-butyl-4-(4-but-3-ynylpiperazin-1-yl)pyrazolo[5,4-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butyl-4-(4-but-3-ynylpiperazin-1-yl)pyrazolo[5,4-d]pyrimidine?
The IUPAC name of 1-tert-butyl-4-(4-but-3-ynylpiperazin-1-yl)pyrazolo[5,4-d]pyrimidine (CID 133407070) is 1-tert-butyl-4-(4-but-3-ynylpiperazin-1-yl)pyrazolo[5,4-d]pyrimidine.
What is the SMILES notation for 1-tert-butyl-4-(4-but-3-ynylpiperazin-1-yl)pyrazolo[5,4-d]pyrimidine?
The canonical SMILES for 1-tert-butyl-4-(4-but-3-ynylpiperazin-1-yl)pyrazolo[5,4-d]pyrimidine is C#CCCN1CCN(c2ncnc3c2cnn3C(C)(C)C)CC1.
What is the InChIKey of 1-tert-butyl-4-(4-but-3-ynylpiperazin-1-yl)pyrazolo[5,4-d]pyrimidine?
The InChIKey is LZUIGMMPYAGEMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24N6/c1-5-6-7-21-8-10-22(11-9-21)15-14-12-20-23(17(2,3)4)16(14)19-13-18-15/h1,12-13H,6-11H2,2-4H3.
What are the key properties of 1-tert-butyl-4-(4-but-3-ynylpiperazin-1-yl)pyrazolo[5,4-d]pyrimidine?
1-tert-butyl-4-(4-but-3-ynylpiperazin-1-yl)pyrazolo[5,4-d]pyrimidine has a molecular weight of 312.42 g/mol, XLogP of 1.73, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butyl-4-(4-but-3-ynylpiperazin-1-yl)pyrazolo[5,4-d]pyrimidine is sourced from PubChem (CID 133407070), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).