C14H24N4O — CID 133407556
N-[2-[[2,6-di(propan-2-yl)pyrimidin-4-yl]amino]ethyl]acetamide (PubChem CID 133407556) has the molecular formula C14H24N4O and a molecular weight of 264.37 g/mol. Its IUPAC name is N-[2-[[2,6-di(propan-2-yl)pyrimidin-4-yl]amino]ethyl]acetamide.
| Compound Name | N-[2-[[2,6-di(propan-2-yl)pyrimidin-4-yl]amino]ethyl]acetamide |
|---|---|
| PubChem CID | 133407556 |
| Molecular Formula | C14H24N4O |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.20 |
| IUPAC Name | N-[2-[[2,6-di(propan-2-yl)pyrimidin-4-yl]amino]ethyl]acetamide |
| SMILES | CC(=O)NCCNc1cc(C(C)C)nc(C(C)C)n1 |
| InChI | InChI=1S/C14H24N4O/c1-9(2)12-8-13(16-7-6-15-11(5)19)18-14(17-12)10(3)4/h8-10H,6-7H2,1-5H3,(H,15,19)(H,16,17,18) |
| InChIKey | XFRQHJWOJOSMPF-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|