About [4-(7-aminopyrido[2,3-d]pyrimidin-4-yl)piperazin-1-yl]-cyclopentylmethanone
[4-(7-aminopyrido[2,3-d]pyrimidin-4-yl)piperazin-1-yl]-cyclopentylmethanone (PubChem CID 133408843) has the molecular formula C17H22N6O
and a molecular weight of 326.40 g/mol. Its IUPAC name is [4-(7-aminopyrido[2,3-d]pyrimidin-4-yl)piperazin-1-yl]-cyclopentylmethanone.
Molecular Properties
| Compound Name | [4-(7-aminopyrido[2,3-d]pyrimidin-4-yl)piperazin-1-yl]-cyclopentylmethanone |
| PubChem CID | 133408843 |
| Molecular Formula | C17H22N6O |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | [4-(7-aminopyrido[2,3-d]pyrimidin-4-yl)piperazin-1-yl]-cyclopentylmethanone |
| SMILES | Nc1ccc2c(N3CCN(C(=O)C4CCCC4)CC3)ncnc2n1 |
| InChI | InChI=1S/C17H22N6O/c18-14-6-5-13-15(21-14)19-11-20-16(13)22-7-9-23(10-8-22)17(24)12-3-1-2-4-12/h5-6,11-12H,1-4,7-10H2,(H2,18,19,20,21) |
| InChIKey | DUXATMKTQMDEOG-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [4-(7-aminopyrido[2,3-d]pyrimidin-4-yl)piperazin-1-yl]-cyclopentylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(7-aminopyrido[2,3-d]pyrimidin-4-yl)piperazin-1-yl]-cyclopentylmethanone?
The IUPAC name of [4-(7-aminopyrido[2,3-d]pyrimidin-4-yl)piperazin-1-yl]-cyclopentylmethanone (CID 133408843) is [4-(7-aminopyrido[2,3-d]pyrimidin-4-yl)piperazin-1-yl]-cyclopentylmethanone.
What is the SMILES notation for [4-(7-aminopyrido[2,3-d]pyrimidin-4-yl)piperazin-1-yl]-cyclopentylmethanone?
The canonical SMILES for [4-(7-aminopyrido[2,3-d]pyrimidin-4-yl)piperazin-1-yl]-cyclopentylmethanone is Nc1ccc2c(N3CCN(C(=O)C4CCCC4)CC3)ncnc2n1.
What is the InChIKey of [4-(7-aminopyrido[2,3-d]pyrimidin-4-yl)piperazin-1-yl]-cyclopentylmethanone?
The InChIKey is DUXATMKTQMDEOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22N6O/c18-14-6-5-13-15(21-14)19-11-20-16(13)22-7-9-23(10-8-22)17(24)12-3-1-2-4-12/h5-6,11-12H,1-4,7-10H2,(H2,18,19,20,21).
What are the key properties of [4-(7-aminopyrido[2,3-d]pyrimidin-4-yl)piperazin-1-yl]-cyclopentylmethanone?
[4-(7-aminopyrido[2,3-d]pyrimidin-4-yl)piperazin-1-yl]-cyclopentylmethanone has a molecular weight of 326.40 g/mol, XLogP of 1.45, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(7-aminopyrido[2,3-d]pyrimidin-4-yl)piperazin-1-yl]-cyclopentylmethanone is sourced from PubChem (CID 133408843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).