C16H16FN5O2S — CID 133411813
N-[1-(2-fluorophenyl)piperidin-3-yl]-5-nitroimidazo[2,1-b][1,3]thiazol-6-amine (PubChem CID 133411813) has the molecular formula C16H16FN5O2S and a molecular weight of 361.40 g/mol. Its IUPAC name is N-[1-(2-fluorophenyl)piperidin-3-yl]-5-nitroimidazo[2,1-b][1,3]thiazol-6-amine.
| Compound Name | N-[1-(2-fluorophenyl)piperidin-3-yl]-5-nitroimidazo[2,1-b][1,3]thiazol-6-amine |
|---|---|
| PubChem CID | 133411813 |
| Molecular Formula | C16H16FN5O2S |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | N-[1-(2-fluorophenyl)piperidin-3-yl]-5-nitroimidazo[2,1-b][1,3]thiazol-6-amine |
| SMILES | O=[N+]([O-])c1c(NC2CCCN(c3ccccc3F)C2)nc2sccn12 |
| InChI | InChI=1S/C16H16FN5O2S/c17-12-5-1-2-6-13(12)20-7-3-4-11(10-20)18-14-15(22(23)24)21-8-9-25-16(21)19-14/h1-2,5-6,8-9,11,18H,3-4,7,10H2 |
| InChIKey | BHCYOGBYZBDAJB-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|