C19H32N4O2 — CID 133412209
4-[1-[2-tert-butyl-6-(methoxymethyl)pyrimidin-4-yl]-4-methylpyrrolidin-3-yl]morpholine (PubChem CID 133412209) has the molecular formula C19H32N4O2 and a molecular weight of 348.49 g/mol. Its IUPAC name is 4-[1-[2-tert-butyl-6-(methoxymethyl)pyrimidin-4-yl]-4-methylpyrrolidin-3-yl]morpholine.
| Compound Name | 4-[1-[2-tert-butyl-6-(methoxymethyl)pyrimidin-4-yl]-4-methylpyrrolidin-3-yl]morpholine |
|---|---|
| PubChem CID | 133412209 |
| Molecular Formula | C19H32N4O2 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.25 |
| IUPAC Name | 4-[1-[2-tert-butyl-6-(methoxymethyl)pyrimidin-4-yl]-4-methylpyrrolidin-3-yl]morpholine |
| SMILES | COCc1cc(N2CC(C)C(N3CCOCC3)C2)nc(C(C)(C)C)n1 |
| InChI | InChI=1S/C19H32N4O2/c1-14-11-23(12-16(14)22-6-8-25-9-7-22)17-10-15(13-24-5)20-18(21-17)19(2,3)4/h10,14,16H,6-9,11-13H2,1-5H3 |
| InChIKey | GONUOIAMPVCYDA-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 50.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |