About N,3-dimethyl-N-[2-(1,3-thiazol-2-yl)ethyl]quinolin-2-amine
N,3-dimethyl-N-[2-(1,3-thiazol-2-yl)ethyl]quinolin-2-amine (PubChem CID 133413137) has the molecular formula C16H17N3S
and a molecular weight of 283.40 g/mol. Its IUPAC name is N,3-dimethyl-N-[2-(1,3-thiazol-2-yl)ethyl]quinolin-2-amine.
Molecular Properties
| Compound Name | N,3-dimethyl-N-[2-(1,3-thiazol-2-yl)ethyl]quinolin-2-amine |
| PubChem CID | 133413137 |
| Molecular Formula | C16H17N3S |
| Molecular Weight | 283.40 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | N,3-dimethyl-N-[2-(1,3-thiazol-2-yl)ethyl]quinolin-2-amine |
| SMILES | Cc1cc2ccccc2nc1N(C)CCc1nccs1 |
| InChI | InChI=1S/C16H17N3S/c1-12-11-13-5-3-4-6-14(13)18-16(12)19(2)9-7-15-17-8-10-20-15/h3-6,8,10-11H,7,9H2,1-2H3 |
| InChIKey | DGLGCNCVXFLYPA-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.40 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N,3-dimethyl-N-[2-(1,3-thiazol-2-yl)ethyl]quinolin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,3-dimethyl-N-[2-(1,3-thiazol-2-yl)ethyl]quinolin-2-amine?
The IUPAC name of N,3-dimethyl-N-[2-(1,3-thiazol-2-yl)ethyl]quinolin-2-amine (CID 133413137) is N,3-dimethyl-N-[2-(1,3-thiazol-2-yl)ethyl]quinolin-2-amine.
What is the SMILES notation for N,3-dimethyl-N-[2-(1,3-thiazol-2-yl)ethyl]quinolin-2-amine?
The canonical SMILES for N,3-dimethyl-N-[2-(1,3-thiazol-2-yl)ethyl]quinolin-2-amine is Cc1cc2ccccc2nc1N(C)CCc1nccs1.
What is the InChIKey of N,3-dimethyl-N-[2-(1,3-thiazol-2-yl)ethyl]quinolin-2-amine?
The InChIKey is DGLGCNCVXFLYPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17N3S/c1-12-11-13-5-3-4-6-14(13)18-16(12)19(2)9-7-15-17-8-10-20-15/h3-6,8,10-11H,7,9H2,1-2H3.
What are the key properties of N,3-dimethyl-N-[2-(1,3-thiazol-2-yl)ethyl]quinolin-2-amine?
N,3-dimethyl-N-[2-(1,3-thiazol-2-yl)ethyl]quinolin-2-amine has a molecular weight of 283.40 g/mol, XLogP of 3.68, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,3-dimethyl-N-[2-(1,3-thiazol-2-yl)ethyl]quinolin-2-amine is sourced from PubChem (CID 133413137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).