About 5-chloro-2-spiro[1,2-dihydroindene-3,2'-morpholine]-4'-ylbenzonitrile
5-chloro-2-spiro[1,2-dihydroindene-3,2'-morpholine]-4'-ylbenzonitrile (PubChem CID 133413282) has the molecular formula C19H17ClN2O
and a molecular weight of 324.81 g/mol. Its IUPAC name is 5-chloro-2-spiro[1,2-dihydroindene-3,2'-morpholine]-4'-ylbenzonitrile.
Molecular Properties
| Compound Name | 5-chloro-2-spiro[1,2-dihydroindene-3,2'-morpholine]-4'-ylbenzonitrile |
| PubChem CID | 133413282 |
| Molecular Formula | C19H17ClN2O |
| Molecular Weight | 324.81 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | 5-chloro-2-spiro[1,2-dihydroindene-3,2'-morpholine]-4'-ylbenzonitrile |
| SMILES | N#Cc1cc(Cl)ccc1N1CCOC2(CCc3ccccc32)C1 |
| InChI | InChI=1S/C19H17ClN2O/c20-16-5-6-18(15(11-16)12-21)22-9-10-23-19(13-22)8-7-14-3-1-2-4-17(14)19/h1-6,11H,7-10,13H2 |
| InChIKey | ONXVXHOSPLTYDU-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 36.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.81 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-chloro-2-spiro[1,2-dihydroindene-3,2'-morpholine]-4'-ylbenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-2-spiro[1,2-dihydroindene-3,2'-morpholine]-4'-ylbenzonitrile?
The IUPAC name of 5-chloro-2-spiro[1,2-dihydroindene-3,2'-morpholine]-4'-ylbenzonitrile (CID 133413282) is 5-chloro-2-spiro[1,2-dihydroindene-3,2'-morpholine]-4'-ylbenzonitrile.
What is the SMILES notation for 5-chloro-2-spiro[1,2-dihydroindene-3,2'-morpholine]-4'-ylbenzonitrile?
The canonical SMILES for 5-chloro-2-spiro[1,2-dihydroindene-3,2'-morpholine]-4'-ylbenzonitrile is N#Cc1cc(Cl)ccc1N1CCOC2(CCc3ccccc32)C1.
What is the InChIKey of 5-chloro-2-spiro[1,2-dihydroindene-3,2'-morpholine]-4'-ylbenzonitrile?
The InChIKey is ONXVXHOSPLTYDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17ClN2O/c20-16-5-6-18(15(11-16)12-21)22-9-10-23-19(13-22)8-7-14-3-1-2-4-17(14)19/h1-6,11H,7-10,13H2.
What are the key properties of 5-chloro-2-spiro[1,2-dihydroindene-3,2'-morpholine]-4'-ylbenzonitrile?
5-chloro-2-spiro[1,2-dihydroindene-3,2'-morpholine]-4'-ylbenzonitrile has a molecular weight of 324.81 g/mol, XLogP of 3.89, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-2-spiro[1,2-dihydroindene-3,2'-morpholine]-4'-ylbenzonitrile is sourced from PubChem (CID 133413282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).