C19H31N3O6 — CID 13341517
(4S,7S)-7-[[(2S)-1-ethoxy-5-methyl-1-oxohexan-2-yl]amino]-6,10-dioxo-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepine-4-carboxylic acid (PubChem CID 13341517) has the molecular formula C19H31N3O6 and a molecular weight of 397.47 g/mol. Its IUPAC name is (4S,7S)-7-[[(2S)-1-ethoxy-5-methyl-1-oxohexan-2-yl]amino]-6,10-dioxo-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepine-4-carboxylic acid.
| Compound Name | (4S,7S)-7-[[(2S)-1-ethoxy-5-methyl-1-oxohexan-2-yl]amino]-6,10-dioxo-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepine-4-carboxylic acid |
|---|---|
| PubChem CID | 13341517 |
| Molecular Formula | C19H31N3O6 |
| Molecular Weight | 397.47 g/mol |
| Exact Mass | 397.22 |
| IUPAC Name | (4S,7S)-7-[[(2S)-1-ethoxy-5-methyl-1-oxohexan-2-yl]amino]-6,10-dioxo-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepine-4-carboxylic acid |
| SMILES | CCOC(=O)[C@H](CCC(C)C)N[C@H]1CCC(=O)N2CCC[C@@H](C(=O)O)N2C1=O |
| InChI | InChI=1S/C19H31N3O6/c1-4-28-19(27)14(8-7-12(2)3)20-13-9-10-16(23)21-11-5-6-15(18(25)26)22(21)17(13)24/h12-15,20H,4-11H2,1-3H3,(H,25,26)/t13-,14-,15-/m0/s1 |
| InChIKey | POBKTGKKUWGPER-KKUMJFAQSA-N |
| XLogP | 0.93 |
| TPSA | 116.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.47 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |