About 4-[(2-ethylthieno[2,3-d]pyrimidin-4-yl)amino]-1-methoxybutan-2-ol
4-[(2-ethylthieno[2,3-d]pyrimidin-4-yl)amino]-1-methoxybutan-2-ol (PubChem CID 133415292) has the molecular formula C13H19N3O2S
and a molecular weight of 281.38 g/mol. Its IUPAC name is 4-[(2-ethylthieno[2,3-d]pyrimidin-4-yl)amino]-1-methoxybutan-2-ol.
Molecular Properties
| Compound Name | 4-[(2-ethylthieno[2,3-d]pyrimidin-4-yl)amino]-1-methoxybutan-2-ol |
| PubChem CID | 133415292 |
| Molecular Formula | C13H19N3O2S |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | 4-[(2-ethylthieno[2,3-d]pyrimidin-4-yl)amino]-1-methoxybutan-2-ol |
| SMILES | CCc1nc(NCCC(O)COC)c2ccsc2n1 |
| InChI | InChI=1S/C13H19N3O2S/c1-3-11-15-12(10-5-7-19-13(10)16-11)14-6-4-9(17)8-18-2/h5,7,9,17H,3-4,6,8H2,1-2H3,(H,14,15,16) |
| InChIKey | LAMVLVBFCNLTCA-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 67.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[(2-ethylthieno[2,3-d]pyrimidin-4-yl)amino]-1-methoxybutan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2-ethylthieno[2,3-d]pyrimidin-4-yl)amino]-1-methoxybutan-2-ol?
The IUPAC name of 4-[(2-ethylthieno[2,3-d]pyrimidin-4-yl)amino]-1-methoxybutan-2-ol (CID 133415292) is 4-[(2-ethylthieno[2,3-d]pyrimidin-4-yl)amino]-1-methoxybutan-2-ol.
What is the SMILES notation for 4-[(2-ethylthieno[2,3-d]pyrimidin-4-yl)amino]-1-methoxybutan-2-ol?
The canonical SMILES for 4-[(2-ethylthieno[2,3-d]pyrimidin-4-yl)amino]-1-methoxybutan-2-ol is CCc1nc(NCCC(O)COC)c2ccsc2n1.
What is the InChIKey of 4-[(2-ethylthieno[2,3-d]pyrimidin-4-yl)amino]-1-methoxybutan-2-ol?
The InChIKey is LAMVLVBFCNLTCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N3O2S/c1-3-11-15-12(10-5-7-19-13(10)16-11)14-6-4-9(17)8-18-2/h5,7,9,17H,3-4,6,8H2,1-2H3,(H,14,15,16).
What are the key properties of 4-[(2-ethylthieno[2,3-d]pyrimidin-4-yl)amino]-1-methoxybutan-2-ol?
4-[(2-ethylthieno[2,3-d]pyrimidin-4-yl)amino]-1-methoxybutan-2-ol has a molecular weight of 281.38 g/mol, XLogP of 2.06, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2-ethylthieno[2,3-d]pyrimidin-4-yl)amino]-1-methoxybutan-2-ol is sourced from PubChem (CID 133415292), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).