C17H21N5O4S — CID 133415864
3-(5-cyclopropyl-1H-1,2,4-triazol-3-yl)-1-(3-methylsulfonyl-2-nitrophenyl)piperidine (PubChem CID 133415864) has the molecular formula C17H21N5O4S and a molecular weight of 391.45 g/mol. Its IUPAC name is 3-(5-cyclopropyl-1H-1,2,4-triazol-3-yl)-1-(3-methylsulfonyl-2-nitrophenyl)piperidine.
| Compound Name | 3-(5-cyclopropyl-1H-1,2,4-triazol-3-yl)-1-(3-methylsulfonyl-2-nitrophenyl)piperidine |
|---|---|
| PubChem CID | 133415864 |
| Molecular Formula | C17H21N5O4S |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.13 |
| IUPAC Name | 3-(5-cyclopropyl-1H-1,2,4-triazol-3-yl)-1-(3-methylsulfonyl-2-nitrophenyl)piperidine |
| SMILES | CS(=O)(=O)c1cccc(N2CCCC(c3n[nH]c(C4CC4)n3)C2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C17H21N5O4S/c1-27(25,26)14-6-2-5-13(15(14)22(23)24)21-9-3-4-12(10-21)17-18-16(19-20-17)11-7-8-11/h2,5-6,11-12H,3-4,7-10H2,1H3,(H,18,19,20) |
| InChIKey | BHDOQYYWJACNHM-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 122.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|