C17H21ClN4 — CID 133416487
6-chloro-2-cyclopropyl-N-[[4-(dimethylamino)phenyl]methyl]-N-methylpyrimidin-4-amine (PubChem CID 133416487) has the molecular formula C17H21ClN4 and a molecular weight of 316.84 g/mol. Its IUPAC name is 6-chloro-2-cyclopropyl-N-[[4-(dimethylamino)phenyl]methyl]-N-methylpyrimidin-4-amine.
| Compound Name | 6-chloro-2-cyclopropyl-N-[[4-(dimethylamino)phenyl]methyl]-N-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 133416487 |
| Molecular Formula | C17H21ClN4 |
| Molecular Weight | 316.84 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | 6-chloro-2-cyclopropyl-N-[[4-(dimethylamino)phenyl]methyl]-N-methylpyrimidin-4-amine |
| SMILES | CN(C)c1ccc(CN(C)c2cc(Cl)nc(C3CC3)n2)cc1 |
| InChI | InChI=1S/C17H21ClN4/c1-21(2)14-8-4-12(5-9-14)11-22(3)16-10-15(18)19-17(20-16)13-6-7-13/h4-5,8-10,13H,6-7,11H2,1-3H3 |
| InChIKey | CXADBZVKQLVCCA-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.84 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|