C18H16ClN5 — CID 133416856
6-[1-(1-benzylpyrazol-4-yl)ethylamino]-3-chloropyridine-2-carbonitrile (PubChem CID 133416856) has the molecular formula C18H16ClN5 and a molecular weight of 337.81 g/mol. Its IUPAC name is 6-[1-(1-benzylpyrazol-4-yl)ethylamino]-3-chloropyridine-2-carbonitrile.
| Compound Name | 6-[1-(1-benzylpyrazol-4-yl)ethylamino]-3-chloropyridine-2-carbonitrile |
|---|---|
| PubChem CID | 133416856 |
| Molecular Formula | C18H16ClN5 |
| Molecular Weight | 337.81 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | 6-[1-(1-benzylpyrazol-4-yl)ethylamino]-3-chloropyridine-2-carbonitrile |
| SMILES | CC(Nc1ccc(Cl)c(C#N)n1)c1cnn(Cc2ccccc2)c1 |
| InChI | InChI=1S/C18H16ClN5/c1-13(22-18-8-7-16(19)17(9-20)23-18)15-10-21-24(12-15)11-14-5-3-2-4-6-14/h2-8,10,12-13H,11H2,1H3,(H,22,23) |
| InChIKey | QEYZPVRLKFEKAM-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 66.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.81 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |