C16H22N4O2 — CID 133417367
2-[[(2S)-1-(2-methylpropyl)pyrrolidin-2-yl]methylamino]-5-nitrobenzonitrile (PubChem CID 133417367) has the molecular formula C16H22N4O2 and a molecular weight of 302.38 g/mol. Its IUPAC name is 2-[[(2S)-1-(2-methylpropyl)pyrrolidin-2-yl]methylamino]-5-nitrobenzonitrile.
| Compound Name | 2-[[(2S)-1-(2-methylpropyl)pyrrolidin-2-yl]methylamino]-5-nitrobenzonitrile |
|---|---|
| PubChem CID | 133417367 |
| Molecular Formula | C16H22N4O2 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | 2-[[(2S)-1-(2-methylpropyl)pyrrolidin-2-yl]methylamino]-5-nitrobenzonitrile |
| SMILES | CC(C)CN1CCC[C@H]1CNc1ccc([N+](=O)[O-])cc1C#N |
| InChI | InChI=1S/C16H22N4O2/c1-12(2)11-19-7-3-4-15(19)10-18-16-6-5-14(20(21)22)8-13(16)9-17/h5-6,8,12,15,18H,3-4,7,10-11H2,1-2H3/t15-/m0/s1 |
| InChIKey | JSLQOODIXFCXPT-HNNXBMFYSA-N |
| XLogP | 3.00 |
| TPSA | 82.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|