C14H22ClN5O — CID 133417486
6-chloro-3-[[(2R)-1-(2-methylpropyl)pyrrolidin-2-yl]methylamino]pyridazine-4-carboxamide (PubChem CID 133417486) has the molecular formula C14H22ClN5O and a molecular weight of 311.82 g/mol. Its IUPAC name is 6-chloro-3-[[(2R)-1-(2-methylpropyl)pyrrolidin-2-yl]methylamino]pyridazine-4-carboxamide.
| Compound Name | 6-chloro-3-[[(2R)-1-(2-methylpropyl)pyrrolidin-2-yl]methylamino]pyridazine-4-carboxamide |
|---|---|
| PubChem CID | 133417486 |
| Molecular Formula | C14H22ClN5O |
| Molecular Weight | 311.82 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | 6-chloro-3-[[(2R)-1-(2-methylpropyl)pyrrolidin-2-yl]methylamino]pyridazine-4-carboxamide |
| SMILES | CC(C)CN1CCC[C@@H]1CNc1nnc(Cl)cc1C(N)=O |
| InChI | InChI=1S/C14H22ClN5O/c1-9(2)8-20-5-3-4-10(20)7-17-14-11(13(16)21)6-12(15)18-19-14/h6,9-10H,3-5,7-8H2,1-2H3,(H2,16,21)(H,17,19)/t10-/m1/s1 |
| InChIKey | JHAQYVMPVPERII-SNVBAGLBSA-N |
| XLogP | 1.76 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.82 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |