C17H18ClN3O2 — CID 133417699
5-chloro-2-[[4-(2,5-dioxopyrrolidin-1-yl)cyclohexyl]amino]benzonitrile (PubChem CID 133417699) has the molecular formula C17H18ClN3O2 and a molecular weight of 331.80 g/mol. Its IUPAC name is 5-chloro-2-[[4-(2,5-dioxopyrrolidin-1-yl)cyclohexyl]amino]benzonitrile.
| Compound Name | 5-chloro-2-[[4-(2,5-dioxopyrrolidin-1-yl)cyclohexyl]amino]benzonitrile |
|---|---|
| PubChem CID | 133417699 |
| Molecular Formula | C17H18ClN3O2 |
| Molecular Weight | 331.80 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | 5-chloro-2-[[4-(2,5-dioxopyrrolidin-1-yl)cyclohexyl]amino]benzonitrile |
| SMILES | N#Cc1cc(Cl)ccc1NC1CCC(N2C(=O)CCC2=O)CC1 |
| InChI | InChI=1S/C17H18ClN3O2/c18-12-1-6-15(11(9-12)10-19)20-13-2-4-14(5-3-13)21-16(22)7-8-17(21)23/h1,6,9,13-14,20H,2-5,7-8H2 |
| InChIKey | LEIKGMYHVDGVHN-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.80 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|