C22H34N4O2 — CID 133417725
1-[4-[(2,6-ditert-butylpyrimidin-4-yl)amino]cyclohexyl]pyrrolidine-2,5-dione (PubChem CID 133417725) has the molecular formula C22H34N4O2 and a molecular weight of 386.54 g/mol. Its IUPAC name is 1-[4-[(2,6-ditert-butylpyrimidin-4-yl)amino]cyclohexyl]pyrrolidine-2,5-dione.
| Compound Name | 1-[4-[(2,6-ditert-butylpyrimidin-4-yl)amino]cyclohexyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 133417725 |
| Molecular Formula | C22H34N4O2 |
| Molecular Weight | 386.54 g/mol |
| Exact Mass | 386.27 |
| IUPAC Name | 1-[4-[(2,6-ditert-butylpyrimidin-4-yl)amino]cyclohexyl]pyrrolidine-2,5-dione |
| SMILES | CC(C)(C)c1cc(NC2CCC(N3C(=O)CCC3=O)CC2)nc(C(C)(C)C)n1 |
| InChI | InChI=1S/C22H34N4O2/c1-21(2,3)16-13-17(25-20(24-16)22(4,5)6)23-14-7-9-15(10-8-14)26-18(27)11-12-19(26)28/h13-15H,7-12H2,1-6H3,(H,23,24,25) |
| InChIKey | QVZVDXSAYCCRCW-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.54 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|