C13H17F3N4O — CID 133418255
N-ethyl-1-[6-(trifluoromethyl)pyridazin-3-yl]piperidine-4-carboxamide (PubChem CID 133418255) has the molecular formula C13H17F3N4O and a molecular weight of 302.30 g/mol. Its IUPAC name is N-ethyl-1-[6-(trifluoromethyl)pyridazin-3-yl]piperidine-4-carboxamide.
| Compound Name | N-ethyl-1-[6-(trifluoromethyl)pyridazin-3-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 133418255 |
| Molecular Formula | C13H17F3N4O |
| Molecular Weight | 302.30 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | N-ethyl-1-[6-(trifluoromethyl)pyridazin-3-yl]piperidine-4-carboxamide |
| SMILES | CCNC(=O)C1CCN(c2ccc(C(F)(F)F)nn2)CC1 |
| InChI | InChI=1S/C13H17F3N4O/c1-2-17-12(21)9-5-7-20(8-6-9)11-4-3-10(18-19-11)13(14,15)16/h3-4,9H,2,5-8H2,1H3,(H,17,21) |
| InChIKey | PSWUGJTUIOESRO-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.30 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |