C16H27N5 — CID 133418859
4-(1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)-N,N-dimethyl-6-propan-2-yl-1,3,5-triazin-2-amine (PubChem CID 133418859) has the molecular formula C16H27N5 and a molecular weight of 289.43 g/mol. Its IUPAC name is 4-(1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)-N,N-dimethyl-6-propan-2-yl-1,3,5-triazin-2-amine.
| Compound Name | 4-(1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)-N,N-dimethyl-6-propan-2-yl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 133418859 |
| Molecular Formula | C16H27N5 |
| Molecular Weight | 289.43 g/mol |
| Exact Mass | 289.23 |
| IUPAC Name | 4-(1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)-N,N-dimethyl-6-propan-2-yl-1,3,5-triazin-2-amine |
| SMILES | CC(C)c1nc(N(C)C)nc(N2CC3CCCCC3C2)n1 |
| InChI | InChI=1S/C16H27N5/c1-11(2)14-17-15(20(3)4)19-16(18-14)21-9-12-7-5-6-8-13(12)10-21/h11-13H,5-10H2,1-4H3 |
| InChIKey | DBBMEVLHAZEREZ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 45.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.43 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |