About 6-[1-(5-benzyl-1,2,4-oxadiazol-3-yl)ethylamino]pyridazine-3-carbonitrile
6-[1-(5-benzyl-1,2,4-oxadiazol-3-yl)ethylamino]pyridazine-3-carbonitrile (PubChem CID 133418971) has the molecular formula C16H14N6O
and a molecular weight of 306.33 g/mol. Its IUPAC name is 6-[1-(5-benzyl-1,2,4-oxadiazol-3-yl)ethylamino]pyridazine-3-carbonitrile.
Molecular Properties
| Compound Name | 6-[1-(5-benzyl-1,2,4-oxadiazol-3-yl)ethylamino]pyridazine-3-carbonitrile |
| PubChem CID | 133418971 |
| Molecular Formula | C16H14N6O |
| Molecular Weight | 306.33 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 6-[1-(5-benzyl-1,2,4-oxadiazol-3-yl)ethylamino]pyridazine-3-carbonitrile |
| SMILES | CC(Nc1ccc(C#N)nn1)c1noc(Cc2ccccc2)n1 |
| InChI | InChI=1S/C16H14N6O/c1-11(18-14-8-7-13(10-17)20-21-14)16-19-15(23-22-16)9-12-5-3-2-4-6-12/h2-8,11H,9H2,1H3,(H,18,21) |
| InChIKey | ZUSNBQNFBZGPGL-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.33 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 6-[1-(5-benzyl-1,2,4-oxadiazol-3-yl)ethylamino]pyridazine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[1-(5-benzyl-1,2,4-oxadiazol-3-yl)ethylamino]pyridazine-3-carbonitrile?
The IUPAC name of 6-[1-(5-benzyl-1,2,4-oxadiazol-3-yl)ethylamino]pyridazine-3-carbonitrile (CID 133418971) is 6-[1-(5-benzyl-1,2,4-oxadiazol-3-yl)ethylamino]pyridazine-3-carbonitrile.
What is the SMILES notation for 6-[1-(5-benzyl-1,2,4-oxadiazol-3-yl)ethylamino]pyridazine-3-carbonitrile?
The canonical SMILES for 6-[1-(5-benzyl-1,2,4-oxadiazol-3-yl)ethylamino]pyridazine-3-carbonitrile is CC(Nc1ccc(C#N)nn1)c1noc(Cc2ccccc2)n1.
What is the InChIKey of 6-[1-(5-benzyl-1,2,4-oxadiazol-3-yl)ethylamino]pyridazine-3-carbonitrile?
The InChIKey is ZUSNBQNFBZGPGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14N6O/c1-11(18-14-8-7-13(10-17)20-21-14)16-19-15(23-22-16)9-12-5-3-2-4-6-12/h2-8,11H,9H2,1H3,(H,18,21).
What are the key properties of 6-[1-(5-benzyl-1,2,4-oxadiazol-3-yl)ethylamino]pyridazine-3-carbonitrile?
6-[1-(5-benzyl-1,2,4-oxadiazol-3-yl)ethylamino]pyridazine-3-carbonitrile has a molecular weight of 306.33 g/mol, XLogP of 2.50, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[1-(5-benzyl-1,2,4-oxadiazol-3-yl)ethylamino]pyridazine-3-carbonitrile is sourced from PubChem (CID 133418971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).