C17H25N3O3 — CID 133419030
methyl 2-methyl-6-(3-methyl-4-morpholin-4-ylpyrrolidin-1-yl)pyridine-3-carboxylate (PubChem CID 133419030) has the molecular formula C17H25N3O3 and a molecular weight of 319.40 g/mol. Its IUPAC name is methyl 2-methyl-6-(3-methyl-4-morpholin-4-ylpyrrolidin-1-yl)pyridine-3-carboxylate.
| Compound Name | methyl 2-methyl-6-(3-methyl-4-morpholin-4-ylpyrrolidin-1-yl)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 133419030 |
| Molecular Formula | C17H25N3O3 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.19 |
| IUPAC Name | methyl 2-methyl-6-(3-methyl-4-morpholin-4-ylpyrrolidin-1-yl)pyridine-3-carboxylate |
| SMILES | COC(=O)c1ccc(N2CC(C)C(N3CCOCC3)C2)nc1C |
| InChI | InChI=1S/C17H25N3O3/c1-12-10-20(11-15(12)19-6-8-23-9-7-19)16-5-4-14(13(2)18-16)17(21)22-3/h4-5,12,15H,6-11H2,1-3H3 |
| InChIKey | KQRUCTNSNWYLJZ-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |