C13H16F3N3S — CID 133419215
4-[6-(trifluoromethyl)pyridazin-3-yl]-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]thiazine (PubChem CID 133419215) has the molecular formula C13H16F3N3S and a molecular weight of 303.35 g/mol. Its IUPAC name is 4-[6-(trifluoromethyl)pyridazin-3-yl]-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]thiazine.
| Compound Name | 4-[6-(trifluoromethyl)pyridazin-3-yl]-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]thiazine |
|---|---|
| PubChem CID | 133419215 |
| Molecular Formula | C13H16F3N3S |
| Molecular Weight | 303.35 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | 4-[6-(trifluoromethyl)pyridazin-3-yl]-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]thiazine |
| SMILES | FC(F)(F)c1ccc(N2CCSC3CCCCC32)nn1 |
| InChI | InChI=1S/C13H16F3N3S/c14-13(15,16)11-5-6-12(18-17-11)19-7-8-20-10-4-2-1-3-9(10)19/h5-6,9-10H,1-4,7-8H2 |
| InChIKey | DLAJIJJRHGQCQF-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.35 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |