About N-(4,4-dimethylcyclohexyl)-N-methyl-3-nitroimidazo[1,2-b]pyridazin-6-amine
N-(4,4-dimethylcyclohexyl)-N-methyl-3-nitroimidazo[1,2-b]pyridazin-6-amine (PubChem CID 133419553) has the molecular formula C15H21N5O2
and a molecular weight of 303.37 g/mol. Its IUPAC name is N-(4,4-dimethylcyclohexyl)-N-methyl-3-nitroimidazo[1,2-b]pyridazin-6-amine.
Molecular Properties
| Compound Name | N-(4,4-dimethylcyclohexyl)-N-methyl-3-nitroimidazo[1,2-b]pyridazin-6-amine |
| PubChem CID | 133419553 |
| Molecular Formula | C15H21N5O2 |
| Molecular Weight | 303.37 g/mol |
| Exact Mass | 303.17 |
| IUPAC Name | N-(4,4-dimethylcyclohexyl)-N-methyl-3-nitroimidazo[1,2-b]pyridazin-6-amine |
| SMILES | CN(c1ccc2ncc([N+](=O)[O-])n2n1)C1CCC(C)(C)CC1 |
| InChI | InChI=1S/C15H21N5O2/c1-15(2)8-6-11(7-9-15)18(3)13-5-4-12-16-10-14(20(21)22)19(12)17-13/h4-5,10-11H,6-9H2,1-3H3 |
| InChIKey | AICJZAVUPHXLMU-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.37 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(4,4-dimethylcyclohexyl)-N-methyl-3-nitroimidazo[1,2-b]pyridazin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4,4-dimethylcyclohexyl)-N-methyl-3-nitroimidazo[1,2-b]pyridazin-6-amine?
The IUPAC name of N-(4,4-dimethylcyclohexyl)-N-methyl-3-nitroimidazo[1,2-b]pyridazin-6-amine (CID 133419553) is N-(4,4-dimethylcyclohexyl)-N-methyl-3-nitroimidazo[1,2-b]pyridazin-6-amine.
What is the SMILES notation for N-(4,4-dimethylcyclohexyl)-N-methyl-3-nitroimidazo[1,2-b]pyridazin-6-amine?
The canonical SMILES for N-(4,4-dimethylcyclohexyl)-N-methyl-3-nitroimidazo[1,2-b]pyridazin-6-amine is CN(c1ccc2ncc([N+](=O)[O-])n2n1)C1CCC(C)(C)CC1.
What is the InChIKey of N-(4,4-dimethylcyclohexyl)-N-methyl-3-nitroimidazo[1,2-b]pyridazin-6-amine?
The InChIKey is AICJZAVUPHXLMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21N5O2/c1-15(2)8-6-11(7-9-15)18(3)13-5-4-12-16-10-14(20(21)22)19(12)17-13/h4-5,10-11H,6-9H2,1-3H3.
What are the key properties of N-(4,4-dimethylcyclohexyl)-N-methyl-3-nitroimidazo[1,2-b]pyridazin-6-amine?
N-(4,4-dimethylcyclohexyl)-N-methyl-3-nitroimidazo[1,2-b]pyridazin-6-amine has a molecular weight of 303.37 g/mol, XLogP of 3.04, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4,4-dimethylcyclohexyl)-N-methyl-3-nitroimidazo[1,2-b]pyridazin-6-amine is sourced from PubChem (CID 133419553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).