About 6-methyl-2,2-dioxo-5-propan-2-yloxathiazin-4-one
6-methyl-2,2-dioxo-5-propan-2-yloxathiazin-4-one (PubChem CID 13341972) has the molecular formula C7H11NO4S
and a molecular weight of 205.23 g/mol. Its IUPAC name is 6-methyl-2,2-dioxo-5-propan-2-yloxathiazin-4-one.
Molecular Properties
| Compound Name | 6-methyl-2,2-dioxo-5-propan-2-yloxathiazin-4-one |
| PubChem CID | 13341972 |
| Molecular Formula | C7H11NO4S |
| Molecular Weight | 205.23 g/mol |
| Exact Mass | 205.04 |
| IUPAC Name | 6-methyl-2,2-dioxo-5-propan-2-yloxathiazin-4-one |
| SMILES | CC1=C(C(C)C)C(=O)NS(=O)(=O)O1 |
| InChI | InChI=1S/C7H11NO4S/c1-4(2)6-5(3)12-13(10,11)8-7(6)9/h4H,1-3H3,(H,8,9) |
| InChIKey | ZABVZJRANSRBKA-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.23 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-methyl-2,2-dioxo-5-propan-2-yloxathiazin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-2,2-dioxo-5-propan-2-yloxathiazin-4-one?
The IUPAC name of 6-methyl-2,2-dioxo-5-propan-2-yloxathiazin-4-one (CID 13341972) is 6-methyl-2,2-dioxo-5-propan-2-yloxathiazin-4-one.
What is the SMILES notation for 6-methyl-2,2-dioxo-5-propan-2-yloxathiazin-4-one?
The canonical SMILES for 6-methyl-2,2-dioxo-5-propan-2-yloxathiazin-4-one is CC1=C(C(C)C)C(=O)NS(=O)(=O)O1.
What is the InChIKey of 6-methyl-2,2-dioxo-5-propan-2-yloxathiazin-4-one?
The InChIKey is ZABVZJRANSRBKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO4S/c1-4(2)6-5(3)12-13(10,11)8-7(6)9/h4H,1-3H3,(H,8,9).
What are the key properties of 6-methyl-2,2-dioxo-5-propan-2-yloxathiazin-4-one?
6-methyl-2,2-dioxo-5-propan-2-yloxathiazin-4-one has a molecular weight of 205.23 g/mol, XLogP of 0.31, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-2,2-dioxo-5-propan-2-yloxathiazin-4-one is sourced from PubChem (CID 13341972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).