C14H25N5O2S — CID 133419746
4-(2,2-dimethyl-1,1-dioxo-1,4-thiazinan-4-yl)-N,N-dimethyl-6-propan-2-yl-1,3,5-triazin-2-amine (PubChem CID 133419746) has the molecular formula C14H25N5O2S and a molecular weight of 327.45 g/mol. Its IUPAC name is 4-(2,2-dimethyl-1,1-dioxo-1,4-thiazinan-4-yl)-N,N-dimethyl-6-propan-2-yl-1,3,5-triazin-2-amine.
| Compound Name | 4-(2,2-dimethyl-1,1-dioxo-1,4-thiazinan-4-yl)-N,N-dimethyl-6-propan-2-yl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 133419746 |
| Molecular Formula | C14H25N5O2S |
| Molecular Weight | 327.45 g/mol |
| Exact Mass | 327.17 |
| IUPAC Name | 4-(2,2-dimethyl-1,1-dioxo-1,4-thiazinan-4-yl)-N,N-dimethyl-6-propan-2-yl-1,3,5-triazin-2-amine |
| SMILES | CC(C)c1nc(N(C)C)nc(N2CCS(=O)(=O)C(C)(C)C2)n1 |
| InChI | InChI=1S/C14H25N5O2S/c1-10(2)11-15-12(18(5)6)17-13(16-11)19-7-8-22(20,21)14(3,4)9-19/h10H,7-9H2,1-6H3 |
| InChIKey | WVWSKNHRKOZNQT-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 79.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.45 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |