C17H18N4 — CID 133419816
6-[(1-benzylcyclobutyl)methylamino]pyridazine-3-carbonitrile (PubChem CID 133419816) has the molecular formula C17H18N4 and a molecular weight of 278.36 g/mol. Its IUPAC name is 6-[(1-benzylcyclobutyl)methylamino]pyridazine-3-carbonitrile.
| Compound Name | 6-[(1-benzylcyclobutyl)methylamino]pyridazine-3-carbonitrile |
|---|---|
| PubChem CID | 133419816 |
| Molecular Formula | C17H18N4 |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | 6-[(1-benzylcyclobutyl)methylamino]pyridazine-3-carbonitrile |
| SMILES | N#Cc1ccc(NCC2(Cc3ccccc3)CCC2)nn1 |
| InChI | InChI=1S/C17H18N4/c18-12-15-7-8-16(21-20-15)19-13-17(9-4-10-17)11-14-5-2-1-3-6-14/h1-3,5-8H,4,9-11,13H2,(H,19,21) |
| InChIKey | SWHDFFKRQMRUOW-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |