C17H22FN3O — CID 133420036
5-[(6-ethyl-5-fluoropyrimidin-4-yl)amino]-4-phenylpentan-2-ol (PubChem CID 133420036) has the molecular formula C17H22FN3O and a molecular weight of 303.38 g/mol. Its IUPAC name is 5-[(6-ethyl-5-fluoropyrimidin-4-yl)amino]-4-phenylpentan-2-ol.
| Compound Name | 5-[(6-ethyl-5-fluoropyrimidin-4-yl)amino]-4-phenylpentan-2-ol |
|---|---|
| PubChem CID | 133420036 |
| Molecular Formula | C17H22FN3O |
| Molecular Weight | 303.38 g/mol |
| Exact Mass | 303.17 |
| IUPAC Name | 5-[(6-ethyl-5-fluoropyrimidin-4-yl)amino]-4-phenylpentan-2-ol |
| SMILES | CCc1ncnc(NCC(CC(C)O)c2ccccc2)c1F |
| InChI | InChI=1S/C17H22FN3O/c1-3-15-16(18)17(21-11-20-15)19-10-14(9-12(2)22)13-7-5-4-6-8-13/h4-8,11-12,14,22H,3,9-10H2,1-2H3,(H,19,20,21) |
| InChIKey | DOXZSHIUMZBEEK-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.38 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |