C14H19N5O2 — CID 133420091
6-[(3-methyl-1-morpholin-4-yl-1-oxobutan-2-yl)amino]pyridazine-3-carbonitrile (PubChem CID 133420091) has the molecular formula C14H19N5O2 and a molecular weight of 289.34 g/mol. Its IUPAC name is 6-[(3-methyl-1-morpholin-4-yl-1-oxobutan-2-yl)amino]pyridazine-3-carbonitrile.
| Compound Name | 6-[(3-methyl-1-morpholin-4-yl-1-oxobutan-2-yl)amino]pyridazine-3-carbonitrile |
|---|---|
| PubChem CID | 133420091 |
| Molecular Formula | C14H19N5O2 |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | 6-[(3-methyl-1-morpholin-4-yl-1-oxobutan-2-yl)amino]pyridazine-3-carbonitrile |
| SMILES | CC(C)C(Nc1ccc(C#N)nn1)C(=O)N1CCOCC1 |
| InChI | InChI=1S/C14H19N5O2/c1-10(2)13(14(20)19-5-7-21-8-6-19)16-12-4-3-11(9-15)17-18-12/h3-4,10,13H,5-8H2,1-2H3,(H,16,18) |
| InChIKey | VCMJRUPOBBQZGY-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 91.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |