C23H29N3O2 — CID 133420760
methyl 6-(1-benzyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)-2-methylpyridine-3-carboxylate (PubChem CID 133420760) has the molecular formula C23H29N3O2 and a molecular weight of 379.50 g/mol. Its IUPAC name is methyl 6-(1-benzyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)-2-methylpyridine-3-carboxylate.
| Compound Name | methyl 6-(1-benzyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)-2-methylpyridine-3-carboxylate |
|---|---|
| PubChem CID | 133420760 |
| Molecular Formula | C23H29N3O2 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.23 |
| IUPAC Name | methyl 6-(1-benzyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)-2-methylpyridine-3-carboxylate |
| SMILES | COC(=O)c1ccc(N2CCC3C(CCCN3Cc3ccccc3)C2)nc1C |
| InChI | InChI=1S/C23H29N3O2/c1-17-20(23(27)28-2)10-11-22(24-17)26-14-12-21-19(16-26)9-6-13-25(21)15-18-7-4-3-5-8-18/h3-5,7-8,10-11,19,21H,6,9,12-16H2,1-2H3 |
| InChIKey | HCHHHOHFVSEHSS-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |